If the balloon had a volume of 3 L at a depth of 50 m, the original volume of the balloon will be
What is Significant figures ?Significant figures are the number of digits in a value, often a measurement, that contribute to the degree of accuracy of the value.
The pressure at a depth of 40 m is the hydrostatic pressure of the water plus the atmospheric pressure.
The hydrostatic pressure P of a liquid is given by the formula ;
P = ρgh
where,
ρ = the density of the liquid (Density of water = 1000 kg m⁻³)g = the acceleration due to gravity (9.81 ms⁻²)h = the depth of the liquid (Given : 50 m)P = 1000 kg m⁻³ x 9.81 ms⁻² x 50 m
= 1000 kg m⁻¹ x 9.81 s⁻² x 50
= 4.9 x 10⁵ Pa
Lets's Convert Pa in to atm
= 4.9 x 10⁵ Pa x 1 / 103. 325 x 10³ Pa
= 4.7 atm
Mow, lets calculate P(atm) ;
P(atm) = 14.7 psi x 1 atm / 14.7 psi
= 1 atm
Total Pressure at 50 m is ;
P(total) = 4.7 atm + 1 atm
= 5.7 atm
Now we can apply Boyle's Law to calculate the volume of the balloon at the surface.
P₁V₁ = P₂V₂
V₂ = P₁V₁ / P₂
According to the question ;
P₁ = 5.7 atm P₂ = 1 atmV₁ = 3 LV₂ = ?V₂ = 3 L x 5.7 atm / 1 atm
= 17.1 L
= 20 L ( 1 significant figure)
Learn more about Boyles law here ;
https://brainly.com/question/1437490
#SPJ1
What are other portals of entry besides needlesticks?
Answer:
Inhalation (via the respiratory tract)Absorption (via mucous membranes such as the eyes) Ingestion (via the gastrointestinal tract)
Explanation:
The opening where an infectious disease enters the host's body such as mucus membranes, open wounds, or tubes inserted in body cavities like urinary catheters or feeding tubes.
What is the balanced form of the chemical equation shown below?
C₂H5OH() + O₂(g) → H₂O(A) + CO₂(g)
Answer: C(2)H(5)OH + 3O(2) —> 3H(2)O + 2CO(2)
Explanation:
*The number in parentheses or
( ) represents the subscript of the element
Carbon-2
Hydrogen-6
Oxygen-7
I hope this is helpful.
(06.06 MC)
How does extreme pressure affect the volume occupied by a real gas compared to the predictions of the ideal gas law? (3 points)
The true volume of the gas will be higher than predicted by the ideal gas law because the volume of the actual particles is more significant under high pressure.
The true volume of the gas will be higher than predicted by the ideal gas law because the attraction between the particles is weaker under high pressure.
The true volume of the gas will be lower than predicted by the ideal gas law because the volume of the actual particles is more significant under high pressure.
The true volume of the gas will be lower than predicted by the ideal gas law because the attraction between the particles is weaker under high pressure.
Answer: The true volume of the gas will be lower than predicted by the ideal gas law because the volume of the actual particles is more significant under high pressure.
What are the blue and yellow circles, the red circles, and the darkest blue ?
Answer:
The Red Circles: Liquid, Blue and Yellow Circles: Solid, and Purple Circles: Gas
Explanation:
Should be it based on the picture and given information.
How does temperature affect Keq of a reaction
In an endothermic reaction, Keq increases as the temperature increases and vice versa.
In an exothermic reaction, Keq decreases as the temperature increases and vice versa.
Keq is the equilibrium constant of a reaction. The equilibrium constant is independent of the concentrations of the reactants and productsThe only factor that the equilibrium constant depends on is the temperature of the system of reactionIn an endothermic reaction, energy is gainedSo a higher temperature is more favourable in an endothermic reactionAs a result, more products are formed at a higher temperature, leading to a higher value of KeqIn an exothermic reaction, energy is releasedSo a lower temperature is more favourable in an exothermic reactionAs a result, fewer products are formed at a higher temperature, leading to a lower value of KeqTherefore, the temperature is the only factor that affects the equilibrium constant of a reaction.
Learn more about equilibrium constants here:
https://brainly.com/question/20344485
#SPJ10
Question 4 (3 points)
The mass of Jupiter is 1.90 x 1027 kg, and the mass of the Sun is 1.99 x 1030 kg. The average
distance between Jupiter and the Sun is 7.78 x 1011 m. What is the gravitational force they exert
on each other?
Answer:
=4.16×10^23Newton
Explanation:
By using formula,
F= GMm/d^2
Acid rain is caused by which of the following?
excess carbon dioxide
deforestation
nitrogen compounds in the soil
nitrogen compounds in the air
Answer:
nitrogen compounds in the air
Explanation:
What is the mass in grams of carbon dioxide that would be required to react with 75.8 g of LiOH in the following chemical reaction? 2 LiOH(s) + CO₂(g) → Li₂CO₃(s) + H₂O(l)
Answer:
69.6 g CO₂
Explanation:
To find the mass of carbon dioxide, you need to (1) convert grams LiOH to moles LiOH (via molar mass from periodic table values), then (2) convert moles LiOH to moles CO₂ (via mole-to-mole ratio from reaction coefficients), and then (3) convert moles CO₂ to grams CO₂ (via molar mass). It is important to arrange the ratios/conversions in a way that allows for the cancellation of units (desired unit in the numerator). The final answer should have 3 sig figs to reflect the given value's sig figs.
Molar Mass (LiOH): 6.9410 g/mol + 15.998 g/mol + 1.008 g/mol
Molar Mass (LiOH): 23.947 g/mol
2 LiOH(s) + 1 CO₂(g) ----> Li₂CO₃(s) + H₂O(l)
Molar Mass (CO₂): 12.011 g/mol + 2(15.998 g/mol)
Molar Mass (CO₂): 44.007 g/mol
75.8 g LiOH 1 mole 1 mole CO₂ 44.007 g
------------------ x ---------------- x ----------------------- x ------------------- =
23.947 g 2 moles LiOH 1 mole
= 69.6 g CO₂
The mass in grams of carbon dioxide that would be required to react with 75.8 g of LiOH is 69.3g
What is Mole?The mole is an amount unit similar to familiar units like pair, dozen, gross, etc. It provides a specific measure of the number of atoms or molecules in a bulk sample of matter.
A mole is defined as the amount of substance containing the same number of atoms, molecules, ions, etc. as the number of atoms in a sample of pure 12C weighing exactly 12 g.
Given,
Mass of LiOH = 75.8g
Moles of LiOH = mass / molar mass
= 75.8 / 24 = 3.15 moles
From the reaction,
2 moles of LiOH react with 1 mole of CO₂
1 mole of LiOH needs 0.5 moles of CO₂
thus, 3.15 moles will need 0.5 × 3.15 moles = 1.575 moles of CO₂
Mass of Carbon dioxide = 1.575 × 44
= 69.3g of carbon dioxide
Therefore, the mass in grams of carbon dioxide that would be required to react with 75.8 g of LiOH is 69.3g
Learn more about Moles, here:
https://brainly.com/question/26416088
#SPJ2
Solve for x , where M is molar and s is seconds.
Enter the answer. Include units. Use the exponent key above the answer box to indicate any exponent on your units.
x=(3.7×103M−2s−1)(0.37M)3
Answer:
187.416 M/s
Explanation:
First the units M^-2 s^-1 * M^3 = M/s
now the numbers
3700 * .37^3 = 187.416
Which reaction is endothermic
Answer:
Option 3
Explanation:
Heat is absorbed, so the reaction is endothermic.
Select only one most suitable description
Why are chemical equations balanced?
Answer:
The bonds between atoms in the reactants are rearranged to form new compounds in chemical reactions, but none of the atoms disappear and no new ones are formed. As a consequence, chemical equations must be balanced, meaning that the number and kinds of atoms must be the same on both sides of the reaction arrow.
Explanation:
Explanation:
because of to obey the law of conservation mass
you know the law of conservation mass states that matter is neither created nor destroyed during chemical reaction means the mass of reactants is equal to the mass of product
Combustion reactions are ones that always include elemental oxygen as a reactant. When a hydrocarbon (substance made up of carbon and hydrogen) reacts with oxygen, the products of the combustion reaction are carbon dioxide and water.
Drag and drop the products to the correct reactants for these combustion reactions. The reactants have the correct coefficients for making balanced reactions.
1. CH4 + 2O2 = CO2 + 2H20 B.
2. 2CH2H6 + 7O2 = 4CO2 + 6H20 A
3. C3H8 + 502 = 3CO2 + 4H20 C
To find the appropriate end products, use the following rules
The hydrogen ratio should be the same on both the product and reactant sidesThe oxygen ratio should be the same on both the product and reactant sidesThe carbon ratio should be the same on both sides.Thus for equation;
1. CH4 + 2O2 = CO2 + 2H20 B.
2. 2CH2H6 + 2O2 = 4CO2 + 6H20 A
3. C2H8 + 502 = 2CO2 + 4H20 C
Learn more about balancing equations here:
https://brainly.com/question/26694427
#SPJ1
The pKb value for aqueous ammonia at 25
is 4.8.
What is the correct pKa value for the ammonium ion at this temperature? (Kb denotes the base dissociation constant and Ka denotes the acid dissociation constant.)
The value of pka for [tex]NH_3[/tex] in an aqueous solution is 9.2.
What is Kb?Kb denotes the base dissociation constant.
pKa + pKb =14 at 25 degree celcius.
pKa + 4.8 =14
pKa = 9.2
pKb is the negative base-10 logarithm of the base dissociation constant (Kb) of a solution.
It is used to determine the strength of a base or alkaline solution.
The value of pka for [tex]NH_3[/tex] in an aqueous solution is 9.2.
Learn more about pka here:
https://brainly.com/question/14124805
#SPJ1
please help with this answe i do not how to to do it it
Answer:
1.20 M (3 s.f.)
Explanation:
In this question, we are trying to find the concentration of KCl after dilution. Note that the number of moles of KCl does not change.
[tex]g \div \frac{g}{mol} = g \times \frac{mol}{g} = mol[/tex]
Number of moles of KCl
= 44.7 ÷74.55
= 0.59960 mol (5 s.f.)
New volume
= 500 mL
= (500 ÷1000) L
= 0.5 L
Concentration after dilution
= 0.59960 ÷0.5
= 1.1992 mol/L
= 1.20 M (3 s.f.)
* M is the symbol for Molarity, which is also equal to mol/L
A hot air balloon is filled with 1.89 x 10² liters of air at 21°C. If atmospheric pressure does not change,
how hot must the air become in order to increase the volume to 4.5 x 10² liters?
Answer:
7.0k x 10^2k
Explanation:
Write and balance the equation for the combustion of the fatty acid stearic acid, (C18H36O2).Express your answer as a chemical equation. Identify all of the phases in your answer.
The combustion of the fatty acid called stearic acid has the the complete equation; C18H36O2(s) + 26O2(g) ------> 18CO2 (g) + 18 H2O(g)
What is combustion?The term combustion has to do with the burning of a substance in air. For organic compounds, we get carbon dioxide and water as the products.
Thus, for the combustion of the fatty acid called stearic acid, the complete equation is; C18H36O2(s) + 26O2(g) ------> 18CO2 (g) + 18 H2O(g)
Learn more about combustion:https://brainly.com/question/15117038?
#SPJ1
Which regulates the flow of electrical current to the filament of the x-ray tube? a. high-voltage circuit
b. low-voltage circuit
c. high-voltage transformer
d. low-voltage transformer
How many moles of H2 are needed to react with 4.8 mol of O2 ?
Answer:
9.6 mol
Explanation:
Start by writing out the balanced equation of the reaction.
2[tex]H_{2}[/tex] + [tex]O_{2}[/tex] ⇒ 2[tex]H_{2}O[/tex]
Here you will see 2 mol of hydrogen for every 1 mol of oxygen. Using this ratio, you can assume the amount of hydrogen will always be double that of oxygen. In this case, 4.8 * 2 = 9.6
What net force is required to cause a 12,000 kg airplane to accelerate at a rate of 5.2 m/s
Fill in the coefficients that will balance the following reaction:
(Note: Use 1 as coefficient where appropriate)
Fe(HCO3)3 + CaO → Fe2O3 + Ca(HCO3)2
Answer:
2 Fe(HCO₃)₃ + 3 CaO ---> 1 Fe₂O₃ + 3 Ca(HCO₃)₂
Explanation:
The unbalanced equation:
Fe(HCO₃)₃ + CaO ---> Fe₂O₃ + Ca(HCO₃)₂
Reactants: 1 iron, 3 hydrogen, 3 carbon, 10 oxygen, 1 calcium
Products: 2 iron, 2 hydrogen, 2 carbon, 9 oxygen, 1 calcium
As you can see, the reaction is clearly unbalanced because the number of each element on both sides is different. The best way to go about balancing an equation is by trying to first balance an element located in only one molecule on either side. For example, I started trying to balance iron. After balancing iron, I looked to balance other elements that would have been affected by the new coefficient (i.e., hydrogen, carbon).
The balanced equation:
2 Fe(HCO₃)₃ + 3 CaO ---> 1 Fe₂O₃ + 3 Ca(HCO₃)₂
Reactants: 2 iron, 6 hydrogen, 6 carbon, 21 oxygen, 3 calcium
Products: 2 iron, 6 hydrogen, 6 carbon, 21 oxygen, 3 calcium
Now, with these coefficients, the quantity of each element on both sides is the same.
5. The rate of diffusion of a gas depends on its
molecular mass and the temperature.
Which combination of molecular mass and
temperature gives the slowest rate of diffusion?
molecular mass
temperature
A.high
high
B.low
low
C.high
low
D.high
low
Answer:
A
Explanation:
because rate of diffusion is inversely proportional to molecular mass
The combination of high molecular mass and low temperature gives the slowest rate of diffusion.The correct option is c.
When it comes to diffusion, the rate at which a gas spreads out depends on its molecular mass and temperature.
Molecular mass refers to the weight of the gas molecules. The larger the molecules, the slower they move and the slower they diffuse. Therefore, gases with higher molecular mass diffuse more slowly than those with lower molecular mass.
Temperature also affects the rate of diffusion. At higher temperatures, gas molecules have more energy and move faster, resulting in a faster diffusion rate. On the other hand, at lower temperatures, gas molecules have less energy and move slower, leading to a slower diffusion rate.
So, when we combine high molecular mass and low temperature, we have both factors working against a fast diffusion rate. The gas molecules are heavy, which slows down their movement, and the low temperature reduces their energy and speed. As a result, this combination gives us the slowest rate of diffusion.
In summary, the combination of high molecular mass and low temperature gives the slowest rate of diffusion.The correct option is C.
Learn more about diffusion,here:
https://brainly.com/question/33792345
#SPJ7
Preparation of ammonia gas
Answer:
Ammonia is easily made in the laboratory by heating an ammonium salt, such as ammonium chloride NH4Cl with a strong alkali, such as sodium hydroxide or calcium hydroxide.
The gas may also be made by warming concentrated ammonium hydroxide.
Explanation:
2NH4Cl + Ca(OH)2 → CaCl2 + 2H2O + 2NH3(g)
Hybridization of bromine in SF4 and arsenic in SF2
Answer:
The answer is C
How many moles of zinc, Zn, are in 1.31×1024 Zn atoms?
Answer:
=7.89013× 10^47 moles of zinc
Explanation:
1 atom contains 6.023×10^23 moles.
1.31×10^24 atoms of zinc contain6.023×10^24×1.31×10^.24
Imagine that a single cell below goes through four cell divisions. How many cells are produced? To find out, draw the parent cell and cells present after each division. Then write the number of cells in the space below each drawing. (Hint: the number of cells doubles with each division.)
16 cells are produced from a single parent cell after the fourth division of the cell.
What is a cell?In biology, the smallest unit can live on its own and that makes up all living organisms and the tissues of the body.
In mitosis type of cell division, one parent cell is divided into two same or different daughter cells. In this way, in the first division, two cells are produced from single parent cells and in the second division, four daughter cells are produced. In the third division, 8 cells are produced from 4 parent cells and in the fourth division, 16 cells are formed from 8 cells.
So we can conclude that 16 cells are produced from a single parent cell after the fourth division of the cell.
Learn more about cell here:
brainly.com/question/13123319
#SPJ1
Which of the following is an impact of an increase in motor vehicles in cities?
Oxygen levels have increased
Carbon dioxide levels have increased
Supply of renewable resources has stopped
Supply of nonrenewable resources has become unlimited
Chemistry: Please make sure to answer each question. Thank you in advance.
Create a diagram of your electroplating apparatus (an electrolytic cell). Then submit your drawing with the following terms labeled correctly. Or, beginning with the positive terminal of the battery and ending with the negative terminal of the battery, describe the path that the electricity takes and where each of the following occurs:
anode
cathode
copper strip
battery
positive terminal
negative terminal
place where oxidation occurs
place where reduction occurs
electrolyte solution
coin (or nail)
direction of electron flow
Answer:
(Score for Question 2: ___ of 7 points)
Describe the results of your procedure with the coin.
Answer:
(Score for Question 1: ___ of 6 points)
Write the two half-reactions that occur in this electroplating process. Be sure to include the states of the elements or ions.
Answer:
The electroplating process of the coin results in the coating of the coin with copper metal.
What is electroplating?Electroplating is the process of using coating the surface of a metal with another one electrolytic cell.
The electroplating of the coin is done using copper as the anode and the coin as the cathode. The electrolyte is copper sulfate solution.
Oxidation occurs at the anode with the copper metal being converted to copper (ii) ions.
Reduction occurred at the cathode as the copper (ii) ions in the solution accept electrons to become copper metal and the coin being coated with copper.
The half-reactions are shown below:
At the anode:
[tex]Cu(s) \rightarrow Cu^{2+}(aq) + 2e^{-}[/tex]
At the cathode:
[tex]Cu^{2+}(aq) + 2e{-} \rightarrow Cu(s)[/tex]
Therefore, the electroplating process of the coin results in the coating of the coin with copper metal.
Learn more about electroplating at: https://brainly.com/question/3913850
#SPJ1
6. Give the balanced full reaction and calculate the E° for galvanic cells based on the
following reactions. Draw diagrams indicating; the anode, cathode, flow of electrons,
salt bridge
(a) Zn^2 (aq) + 2e- = Zn(s)
Pb²(aq) + 2e- → Pb(s)
(b) Cr2O7 + 14H + 6e- 2Cr³+ 7H₂O
H₂O2 + 2H+ + 2e- →2H₂O
Electrochemical cell is one in which energy is released by a chemical action.
What is an electrochemical cell?An electrochemical cell is one in which energy is released by a chemical action.
Now we have the reaction;
Zn^2 (aq) + 2e- = Zn(s)
Pb²(aq) + 2e- → Pb(s)
and
Cr2O7 + 14H + 6e- 2Cr³+ 7H₂O
H₂O2 + 2H+ + 2e- →2H₂O
In the first case, the Ecell is obtained from;
(-0.13 V) - (-0.76 V)
= 0.63 V
In the second case;
1.78 V - 1.33 V
= 0.45 V
Learn more about electrochemical cell:https://brainly.com/question/12034258?
#SPJ1
IUPAC NAME OF CH3CH2CH(CH3)CH2CH(C3H7)-CH3?
Answer:
the IUPAC name is: 2-ethyl-3-methyl-pentanal
Answer:
Thus IUPAC name is: 3-methylpentane. Was this answer helpful?
Explanation:
hope it will help you
