Question 12 Consider the following unbalanced chemical equation for the reaction which is used to determine blood alcohol levels: H 1 + 1+ + Cr 2 2 ​ O 7 7 ​ 2 − 2− + C 2 2 ​ H 6 6 ​ O → → Cr 3 + 3+ + CO 2 2 ​ + H 2 2 ​ O Balance the equation using the smallest whole number coefficients. What is the coefficient in front of carbon dioxide in the balanced chemical equation? 1 point 2 1 3 4 none of the other answers is correct

The solution of KCl in water will undergo precipitation of KCl crystals as the temperature decreases from 50 °C to 20 °C and then to 34 °C due to the decreasing solubility of KCl in water.

What happens to a solution of KCl in water when cooled from 50 °C to 20 °C and then to 34 °C?

When the solution of KCl in water is cooled from 50 °C to 20 °C, the solubility of KCl in water decreases. As a result, some of the KCl will start to come out of the solution and form solid crystals.

Then, when the temperature of the solution is further decreased from 20 °C to 34 °C, the solubility of KCl in water decreases even further, causing more KCl to come out of the solution and form solid crystals. This is known as precipitation.

The amount of KCl that will come out of the solution depends on the solubility of KCl at the respective temperatures. The solubility of KCl in water is about 34 g/100 mL at 20 °C and about 42 g/100 mL at 34 °C. Therefore, when the solution is cooled from 50 °C to 20 °C, some KCl will come out of solution until the concentration in solution reaches about 34 g/100 mL. Further cooling to 34 °C will cause more KCl to come out of solution until the concentration in solution reaches about 42 g/100 mL.

The exact amount of KCl that will come out of solution can be calculated using thermodynamic models and experimental data on the solubility of KCl in water at different temperatures.

To learn more about precipitation, visit: https://brainly.com/question/14160641

#SPJ1

We can see here that matching the label to the correct description, we will have to have a complete part of the description and have a full understanding of what ball-and-stick model is all about.

A specific kind of molecular model called the ball-and-stick model uses balls to represent atoms and sticks to represent the connections connecting them to depict the three-dimensional structure of molecules.

It is a physical model that enables researchers to see the configuration of atoms within a molecule and comprehend their interrelationships.

Learn more about ball-and-stick model on https://brainly.com/question/10416015

#SPJ1

The new volume of the helium gas is 0.39 L.

The new volume of the helium gas is calculated by applying the following formula as shown below:

n₁V₁ = n₂V₂

where;

the final number of moles is calculated as;

n₂ = 0.51 g/4 g/mol

n₂ = 0.1275 mol

The final volume of the gas;

V₂ =(n₁V₁)/n₂

V₂ = (0.1 x 0.5 L )/ (0.1275)

V₂ = 0.39 L

Learn more about final volume of gas here: https://brainly.com/question/25736513

#SPJ1

The vapor pressure of methanol at 40°C is 0.234 atm.

Only two types of alcohol are methanol and ethanol. Ethanol, sometimes referred to as ethyl alcohol, has a chemical composition of two carbon atoms. Methanol, sometimes referred to as methyl alcohol, is made up of just one carbon atom.

ln(P2/P1) = (ΔHvap/R) x (1/T1 - 1/T2)

ΔGvap = -RTln(Pvap/P) = ΔHvap - TΔSvap

ΔGvap = -RTln(Pvap/P) = -166.6 kJ/mol

ΔSvap = S(g) - S(l) = 239.9 J/mol-K - 126.8 J/mol-K = 113.1 J/mol-K

ΔHvap = ΔGvap + TΔSvap = -166.6 kJ/mol + (298.15 K)(113.1 J/mol-K) = -134.6 kJ/mol

Now we can use the Clausius-Clapeyron equation to find the vapor pressure of methanol at -30°C and 40°C.

At -30°C, we have:

T1 = 25°C + 273.15 = 298.15 K

T2 = -30°C + 273.15 = 243.15 K

ΔHvap = -134.6 kJ/mol

R = 8.314 J/mol-K

ln(P2/5 atm) = (-134.6 kJ/mol / 8.314 J/mol-K) x (1/298.15 K - 1/243.15 K)

P2 = 0.0038 atm

Therefore, the vapor pressure of methanol at -30°C is 0.0038 atm.

At 40°C, we have:

T1 = 25°C + 273.15 = 298.15 K

T2 = 40°C + 273.15 = 313.15 K

ΔHvap = -134.6 kJ/mol

R = 8.314 J/mol-K

ln(P2/5 atm) = (-134.6 kJ/mol / 8.314 J/mol-K) x (1/298.15 K - 1/313.15 K)

P2 = 0.234 atm

To know more about vapor pressure visit:-

https://brainly.com/question/11864750

#SPJ1

20.0 moles of oxygen react with Antimony to form 13.3 moles of Antimony (III) Oxide. We want to calculate how many moles of Antimony (III) Oxide will be formed from 20.0 moles of oxygen. This is a stoichiometry problem.

The link between the proportional amounts of components participating in a reaction or generating a compound is known as stoichiometry, and it is often expressed as a ratio of whole integers.

Assuming a balanced chemical equation, the stoichiometric ratio between Antimony (III) Oxide  and oxygen can be used to determine the number of moles of Antimony (III) Oxide  formed.

For example, the balanced equation for the reaction of Antimony with O2 to form Antimony (III) Oxide  is:

4 Antimony + 3 O2 → 2 Antimony (III) Oxide

From this equation, it can be seen that 3 moles of oxygen react with 2 moles of Antimony (III) Oxide . Therefore, if there are 20.0 moles of O2, then the number of moles of Antimony (III) Oxide  formed would be:

20.0 moles oxygen × (2 moles Antimony (III) Oxide  / 3 moles oxygen) = 13.3 moles Antimony (III) Oxide.

To know more about moles visit:-

https://brainly.com/question/26416088

#SPJ1

A student calculates the density of five different pieces of aluminum, each having a different volume Volume vs Density graph best represents this relationship.

Volume is the measure of an object's three-dimensional space. It is often referred to as the capacity of a container, or the amount of space an object occupies. Volume is measured in cubic units such as cubic centimeters (cm3), cubic meters (m3), or cubic feet (ft3). Volume is an important concept in mathematics and is used to calculate the amount of material an object is made from, the capacity of a container, and the amount of space a figure occupies. Volume is also used to calculate the amount of liquid, gas, or other material that can fit into a container.

To learn more about Volume

https://brainly.com/question/27100414

#SPJ1

Sodium bicarbonate is the limiting reactant and just 0.65 moles of CO₂ can be produced.

Limiting reactant is the reactant that gets consumed completely in a chemical reaction, thereby limiting the amount of product that can be formed.

Acetic acid and sodium bicarbonate react, and the balanced chemical equation for this reaction is:

CH₃COOH + NaHCO₃ -> CH₃COONa + CO₂ + H₂O

Calculating the quantity of product that can be created from each reactant and comparing them to discover which one generates the least will help us identify the limiting reactant. The reactant that produces less product is the limiting reactant.

The provided amounts of each reactant must first be converted to moles:

0.80 moles of acetic acid

0.65 moles of sodium bicarbonate

Then, we may determine how much CO₂ can be created from each reactant using stoichiometry. The balanced equation reveals that 1 mole of acetic acid and 1 mole of sodium bicarbonate combine to create 1 mole of carbon dioxide.

Using acetic acid:

0.80 moles CH₃COOH x (1 mole CO₂ / 1 mole CH₃COOH) = 0.80 moles CO₂

About sodium bicarbonate:

0.65 moles NaHCO₃ x (1 mole CO₂ / 1 mole NaHCO₃) = 0.65 moles CO₂

As 0.65 moles of CO₂ are fewer than 0.80 moles of CO₂, sodium bicarbonate is the limiting reactant. Just 0.65 moles of CO₂ can be produced as a result.

Dimensional analysis:

0.80 moles CH₃COOH x (1 mole CO₂ / 1 mole CH₃COOH) x (44.01 g CO₂ / 1 mole CO₂) = 35.21 g CO₂

0.65 moles NaHCO₃ x (1 mole CO₂ / 1 mole NaHCO₃) x (44.01 g CO₂ / 1 mole CO₂) = 28.61 g CO₂

Learn more about moles here:

https://brainly.com/question/20486415

#SPJ1

A solution with a pH of 9.7 contains the hydronium ion. [tex]1x10^-9.7[/tex]M, which is equivalent to approximately [tex]2.01x10^-10 M.[/tex]

You must be aware of the hydronium ion concentration expressed in moles per litre (molarity) in order to calculate the pH of an aqueous solution. The pH is then calculated using the equation pH = - log [H3O+].

At the far end, there are no more than 1M hydrogen ions, which leads to a pH of no more than 0. The pH value is limited to 14, whereas the other end contains no more than 1M of hydroxide ions.

Question:

[tex]The [H3O+] of a solution with pH = 9.7 is 9.7 M O 1x 109.7M O2 x 10-10 M O 5 x 10-5M 09.7 x 10-1 M The [H3O+] of a solution with pH = 9.7 is 09.7 M O 1x 109.7 M 2 x 10-10 M. 0 5x 10-5m 09.7 10-1 M.[/tex]

To know more about Hydronium ion visit:-

https://brainly.com/question/14619642

#SPJ1

Answer: A terrestrial phenomenon commonly referred to as lunar eclipse transpires during an astronomical event wherein the Earth traverses its orbit between the Sun and the Moon, resulting in an obstruction and projection of its shade onto the lunar surface. During a lunar eclipse, the moon may exhibit a crimson tint owing to the Earth's atmosphere refracting sunlight towards the moon. This phenomenon is commonly referred to as a "blood moon" in academic discourse. The acquisition of photographic images of lunar eclipses necessitates the utilization of a camera and a tripod. However, it is imperative to exercise care with respect to exposure duration and ISO settings to facilitate the capture of the subdued illumination emitted by the eclipsed moon. An upcoming celestial phenomenon, which is anticipated to be observable from Earth, is the occurrence of a lunar eclipse on May 16, 2022.

Explanation:

Answer:

To calculate the mass of an atom of silver, we need to know the number of protons and neutrons in the nucleus of the atom. The atomic number of silver is 47, which means it has 47 protons in its nucleus. The mass number of silver is 108, which means that the total number of protons and neutrons in its nucleus is 108. Therefore, the mass of an atom of silver is approximately 108 times the mass of a single proton or neutron. This is because the mass of an electron is much smaller than the mass of a proton or neutron and can be neglected. The mass of a single proton or neutron is approximately 1 atomic mass unit (amu), so the mass of an atom of silver is approximately 108 amu.

The methyl orange indicator will change from red to yellow at the titration's endpoint.

An acid-base indicator called methyl orange changes color between the pH ranges of 3.1 and 4.4. In acidic and basic solutions it is red and yellow, respectively

In this instance, an acid, hydrochloric acid, is being used to titrate the barium hydroxide solution. The pH of the solution will fall as we add the acid since it will neutralize the base. The hue of the methyl orange indicator will vary when the pH ranges from 3.1 to 4.4

All of the barium hydroxide will have interacted with the hydrochloric acid by the time the titration is complete leaving a neutral solution. When the methyl orange indicator becomes yellow the solution's pH is in the basic range.

Therefore, the methyl orange indicator will change from red to yellow at the titration's endpoint.

Learn more about acid-base indicator here: brainly.com/question/1918667

#SPJ1

Answer:  the new volume of the gas is twice the initial volume when the pressure is reduced to half at constant temperature.

Explanation:

As a result, the ideal gas law is applied, and the pressure of the gas in the container is 1.44 atm.

The Kelvin temperature and hence the volume are going to be in direct proportion when the pressure on a sample of a dry gas is held constant, according to the definition of the Charles Law Formula. PV = k is the law's equation, and k might be a constant.

This issue can be resolved by applying the ideal gas law:

PV = nR

T = -52 °C + 273.15 = 221.15 K

n = 0.642 mol

V = 8.6 L

T = 221.15 K

[tex]R = 0.0821 L·atm/mol·K (gas constant for ideal gases)[/tex]

PV = nRT

P = nRT/V

P = (0.642 mol)(0.0821 L·atm/mol·K)(221.15 K)/(8.6 L)

P = 1.44 atm

To know more about ideal gas visit:-

https://brainly.com/question/28257995

#SPJ1

The value of (approximate) z-score for an area of 0.1500 to the left of the z-score in a standard normal distribution is approximately -1.04.

If the area to the left of a z-score is 0.15 this means that 15% of the area under the standard normal distribution curve is to the left of the z-score. To find the approximate z-score, we can use a table of standard normal probabilities or a calculator that has a normal distribution function.

Using a standard normal distribution table, we can look up the closest probability to 0.15 in the table, which is 0.1492. The corresponding z-score is approximately -1.04.

This is how you arrive at the approximate z-score for an area of 0.1500 to the left of the z-score in a standard normal distribution which is approximately -1.04.

Learn more about standard normal distribution here:

https://brainly.com/question/29509087

#SPJ1

5.82 x 10⁶ atoms of H₂O can produce 72800 L of NaOH.

An exothermic mist from the commencement of high temperatures and heat from the breakdown of incompatible combinations can emerge from the reaction of NaOH with H₂O₂, which creates a powerful oxidant known as Na₂O₂ and poses a serious thermal danger.

5.82 x 10⁶ atoms / 3 atoms per mole = 1.94 x 10⁶ moles of H₂O

1.94 x 10⁶ moles of H₂O x (4 moles of NaOH / 2 moles of H₂O) = 3.88 x 10⁶ moles of NaOH

To convert moles of NaOH to liters, we need to use the density of NaOH and its molar mass. The molar mass of NaOH is:

23 g/mol (for Na) + 16 g/mol (for O) + 1 g/mol (for H) = 40 g/mol

The density of NaOH is 2.13 g/mL. Using these values, we can calculate the volume of NaOH produced:

3.88 x 10⁶ moles of NaOH x 40 g/mol = 1.55 x 10⁸ g of NaOH

1.55 x 10⁸ g / 2.13 g/mL = 7.28 x 10⁷ mL

7.28 x 10⁷ mL / 1000 mL/L = 72800 L

To know more about atoms visit:-

https://brainly.com/question/30898688

#SPJ1

a. A gestation period of 13.9 months has a standard score of -1.36.

b. Approximately 99.7% will fall within three standard deviations of the mean.

c. A gestation period of 19 months is very unlikely to occur in a normal distribution, and it would be considered unusual.

What is standard score?

a. To find the standard score associated with a gestation period of 13.9 months, we use the formula:

z = (x - μ) / σ

where x is the gestation period, μ is the mean gestation period, and σ is the standard deviation. Plugging in the values given, we get:

z = (13.9 - 15) / 1.1 = -1.36

Therefore, a gestation period of 13.9 months has a standard score of -1.36.

Empirical Rule:

b. Using the Empirical Rule, we know that approximately 68% of the gestation periods will fall within one standard deviation of the mean, approximately 95% will fall within two standard deviations of the mean, and approximately 99.7% will fall within three standard deviations of the mean.

Since we found the standard score in part a, we can use it to calculate the percentage of whale pregnancies that will have a gestation period between 13.9 and 15 months. This gestation period range is within one standard deviation of the mean, so we can say that approximately 68% of whale pregnancies will fall within this range.

What is gestation period?

c. A gestation period of 19 months is more than three standard deviations away from the mean gestation period of 15 months. Using the Empirical Rule, we can say that approximately 99.7% of the gestation periods will fall within three standard deviations of the mean. Therefore, a gestation period of 19 months is very unlikely to occur in a normal distribution, and it would be considered unusual.

To know more about gestation period, visit:

https://brainly.com/question/22372745

#SPJ1

The same components always present the same ratios in a compound. Water always has two hydrogen atoms for oxygen, and carbon dioxide always contains two oxygen atoms for every one of carbon.

Considering that each of them is composed of two similar atoms, elements include hydrogen, oxygen, and nitrogen. Water is not an element since it only contains two hydrogen atoms and one oxygen atom.

Pure substances include both elements and compounds. Substances made up of many atom types are known as compounds. The simplest compounds are called elements because they only contain one kind of atom.

to know more about elements here;

brainly.com/question/13025901

#SPJ1

The percent composition of iron, carbon, and nitrogen in Prussian Blue is approximately 56.27%, 15.38%, and 28.35%, respectively. The exact percentage of hydrogen depends on the value of x in the formula.

When evaluating a chemical complex, knowing the percentage composition of a certain element inside it may be helpful. The formula for percent composition is 100 times the product of the element's mass and its molecular mass.

It is free of sulphur and phosphorus and contains 48% iron. Siderite-smithsonite, siderite-magnesite, and siderite-rhodochrosite are solid solutions formed when zinc, magnesium, and manganese are substituted for iron.

To know more about Prussian Blue visit:-

https://brainly.com/question/26728476

#SPJ1

Filtration is the process of passing a liquid containing contaminants through a filter to get a cleaner liquid.

After filtration impurities are left on the filter when the liquid goes through it, resulting in a cleaner combination. The procedure of separating one ingredient from another in a compound is used in the purification of chemical compounds or any materials. A mixed sample is turned into fresh samples, each of which contains a single ingredient.Separation procedures are then utilised to separate these compounds. These techniques alter the relative proportions of components in a combination.The type of the compounds and the impurities in them influence the purification of organic chemicals and compounds.

Purification of compounds can be done in other methods as well such as distillation, chromatography, sublimation and crystallisation.

Learn more about filtration here:

https://brainly.com/question/31504556

#SPJ1

Full question:

What can you conclude after learning about filtration of solutions of organic compounds? Name other methods of purification of compounds.

Answer:

b) warm

Explanation:

A warm weather front forms when a warm air mass pushes into a cooler air mass. Therefore, the answer is b) warm.

I'm sorry to bother you but can you please mark me BRAINLEIST if this ans is helpfull

The total pressure in the container will become 4.02 atm when 0.240 mol of a third gas is added.

In accordance with Dalton's law of partial pressures:

P_total = P_A + P_B = 0.352 atm + 0.715 atm = 1.067 atm

When 0.240 mol of a third gas is further introduced, the overall number of moles of gas in the vessel jumps to:

n_total = n_A + n_B + n_3 = (P_A * V)/(R * T) + (P_B * V)/(R * T) + n_3

for no change in volume

n_total = (P_total * V)/(R * T) + n_3

P_total = (n_total - n_3) * (R * T)/V

Substituting the given value:

P_total = (0.352 + 0.715 + 0.240) * (0.0821 * (25 + 273.15))/7.95

P_total = 1.307 x 3.079

P_total =  4.024 atm

Learn more about partial pressures at

https://brainly.com/question/19813237

#SPJ1

The volume of a 60% solution by mass that is prepared with 45 grams of a particular solute is 75 mL.

Firstly, to calculate the volume of the solution, we need to know the density of the solution. Since it is not mentioned in the question, we can assume it to be 1 g/ml.

Next, we can use the formula:

mass of solute = (mass of solution) x (percent by mass)

Here, the mass of solution is the mass of solute plus the mass of solvent.

Or, the mass of solute + the mass of solvent = the mass of solution

Therefore,

The mass of solvent = the mass of solution - the mass of solute

Substituting the values provided in the question, we get:

mass of solvent = (45) / (0.6) - 45 (since the solution is 60%)

mass of solvent = 75 - 45 = 30 g

Thus, mass of the solvent = 30g

Since volume = mass / density

The volume of the 60% solution = mass of solution / density

volume of solution = (45 + 30) / (1)

volume of solution = 75 mL

Thus, 75 mL of the 60% solution by mass is made with 45g of solute.

Learn more about volume and density here:

https://brainly.com/question/10821730

#SPJ1

Answer:Pb2O3

Explanation:

lead (III) has a +3 charge

Oxygen has a -2 charge

You need 2 Pb to balance with the 3

The answers to the given questions are; 58 Joules = 13.86 Calories, 230 Calories = 962.32 Joules, 230 Calories = 0.96 kJ, and 3.2 kJ = 0.7648 kCal.

(i) We know that, 4.184 Joules = 1 Calorie

                     ==> 1 Joule = 1 / 4.184 Calories

     Therefore, 58 Joules = [ (1 / 4.184) * 58 ] Calories

                                         = 13.86 Calories (Approx.)

(ii) We know, 1 Calorie = 4.184 Joules

   Then,  230 Calories = 4.184 * 230 Joules

                                     = 962.32 Joules

(iii) We know, 230 Calories = 962.32 kJ(from previous question)

                 and, 1000Joules = 1 kJ

                           ==> 1 Joule = (1 / 1000) kJ

Therefore, 230 Calories i.e., 962.32 Joules = [ (1 / 1000) * 962.32 ] kJ

                                                                        = 0.96kJ (Approx.)

(iii) We know, 4.184 Joules = 1 Calorie

                ==> 1 Joule = (1 / 4.184) Calorie

                ==> 1000Joules i.e, 1 kJ = (1 / 4.184) * 1000 Calories

                Therefore, 3.2 kJ = [ { ( 1 / 4.184 ) * 1000 } * 3.2 ] Calories

                                              = 764.82 Calories(Approx.)

             Since, 1000 Calories = 1 kCal

                      764.81 Calories = [(1 / 1000) * 764.82 ] kCal

                             i.e., 3.2 kJ  = 0.7648 KCal (Approx.)

To learn more about another unit of energy:

https://brainly.com/question/26066425

Answer:

Explanation:

The equilibrium constant expression for the given reaction is:

K = ([C6H5COO-][C6H5NH3+])/([C6H5COOH][C6H5NH2])

We can use the acid dissociation constant (Ka) for benzoic acid and the base dissociation constant (Kb) for aniline to solve for the equilibrium constant (K) of the reaction.

Ka = [C6H5COO-][H3O+]/[C6H5COOH]

[H3O+] = Ka*[C6H5COOH]/[C6H5COO-]

Kb = [C6H5NH3+][OH-]/[C6H5NH2]

[OH-] = Kb*[C6H5NH2]/[C6H5NH3+]

Substituting [H3O+] and [OH-] into the equilibrium constant expression and simplifying, we get:

K = (Ka*Kb)/([H3O+][OH-])

K = (6.3×10^(-5))(4.3×10^(-10))/((KaC6H5NH2)(KbC6H5COOH))

K = (6.3×10^(-5))*(4.3×10^(-10))/(1.00×10^(-14))

K = 2.73×10^(-2)

Therefore, the equilibrium constant for the given reaction is 2.73×10^(-2).

The four types of physical weathering are:

1.) Frost action or freeze-thaw weathering

2.) Exfoliation or unloading

3.) Thermal expansion and contraction

4.) Abrasion

These types of weathering are similar in that they all involve physical processes that break down rocks and other geological materials without the involvement of chemical reactions.

Frost action occurs when water seeps into cracks in rocks and freezes, causing the water to expand and exert pressure on the surrounding rock. This process repeats over time and can cause the rock to fracture and break apart.

Exfoliation occurs when rocks that were once buried deep beneath the earth's surface are exposed to lower pressures as overlying rocks erode away. As the pressure decreases, the rocks expand and crack, causing outer layers of rock to peel away like layers of an onion.

Thermal expansion and contraction occurs when rocks are repeatedly subjected to heating and cooling cycles. This can cause the rock to expand and contract, leading to the development of cracks and fractures.

Abrasion occurs when rocks and other geological materials are subjected to repeated rubbing or grinding by other materials, such as wind-blown sand, water, or other rocks. This process can cause rocks to wear down and break apart over time.

In summary, these four types of physical weathering are similar in that they all involve physical processes that break down rocks and other geological materials, but each type operates under different conditions and results in different forms of weathering.

Answer:

below

Explanation:

The four types of physical weathering are:

1. Freeze-thaw weathering

2. Exfoliation

3. Abrasion

4. Thermal expansion and contraction

These types of physical weathering are similar in that they all involve the breakdown of rocks and other geological features due to physical forces rather than chemical reactions. In each case, the physical stress causes the rock to crack or break apart. Additionally, they all can occur in various types of climates and environmental conditions.

The subshell with quantum numbers n=2 and l=2 is the 2D subshell.

The set of numbers used to describe the position and energy of the electron in an atom are called quantum numbers.

There are four known quantum numbers, and they include:

The  principal quantum number (n) indicates the energy level or shell of an electron, while the azimuthal quantum number (l) indicates the shape of the electron cloud or subshell.

Learn more about quantum number at: https://brainly.com/question/2292596

#SPJ1

The new pressure inside the balloon will be 1.91 atm after the gas is compressed to a volume of 4.6 L.

The scientist Robert Boyle discovered this empirical relationship in 1662, which asserts that under constant temperature, the pressure (p) of a given quantity of gas changes inversely with its volume (v). As a result, the equation pv = k, a constant, is produced.

P1 x V1 = P2 x V2

where the starting pressure and volume are P1 and V1, and the ultimate pressure and volume are P2 and V2.

Plugging in the given values, we get:

1.35 atm x 6.5 L = P2 x 4.6 L

Solving for P2, we get:

P2 = (1.35 atm x 6.5 L) / 4.6 L

P2 = 1.91 atm

To know more about volume visit:-

https://brainly.com/question/13986930

#SPJ1